1,7-Phenanthroline is a research compound with a tricyclic aromatic structure containing two nitrogen atoms. It is primarily used as a laboratory reagent for chemical synthesis and coordination chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 230-46-6
MPTP hydrochloride
research compound
(1A-methyl-6-oxo-3-phenoxy-1,1a,6,6a-tetrahydroindeno[1,2-b]azirine-6a-carbonyl)glycine
research compound
Bis[(-)-pinanediolato]diboron
borylation reagent for organic synthesis
Bis(hexylene glycolato)diboron
boron reagent for organic synthesis
1,7-phenanthroline
OZKOMUDCMCEDTM-UHFFFAOYSA-N
C1=CC2=C(C3=C(C=C2)N=CC=C3)N=C1