Bis[(-)-pinanediolato]diboron is a chiral diboron compound used as a borylation reagent in organic synthesis. It is primarily employed in research settings for the introduction of boron-containing groups into organic molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 230299-17-9
Bis(hexylene glycolato)diboron
boron reagent for organic synthesis
2,6-Bis(N-pyrazolyl)pyridine nickel (II) dichloride
research catalyst ligand complex
2-bromo-4-methyl-3-nitro-pyridine
research compound
R8-T198wt
research compound
(1R,2R,6S,8R)-2,9,9-trimethyl-4-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane
VNEZFUGEQURPEN-COLRIBGKSA-N
B1(O[C@H]2C[C@H]3C[C@@H]([C@]2(O1)C)C3(C)C)B4O[C@H]5C[C@H]6C[C@@H]([C@]5(O4)C)C6(C)C