3-Aminophthalic acid is a chemical compound that forms as a product when luminol undergoes oxidation in the presence of a catalyst. It is primarily significant as a reagent used in chemiluminescence assays, including forensic applications where luminol and hydrogen peroxide are employed to detect traces of blood.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 5434-20-8
1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride
research compound
5-(2-NITRO-PROPENYL)-BENZO(1,3)DIOXOLE
research compound
Cytidine 5'-diphosphate disodium salt
nucleoside diphosphate research reagent
1-IODOHEXADECANE
Laboratory reagent
Dimethylzinc
organometallic reagent for chemical synthesis
3-aminophthalic acid
WGLQHUKCXBXUDV-UHFFFAOYSA-N
C1=CC(=C(C(=C1)N)C(=O)O)C(=O)O