Cytidine 5'-diphosphate disodium salt is a nucleoside diphosphate consisting of a pyrophosphate group attached to the sugar ribose and the nucleobase cytosine. It is commonly used as a research reagent in studies involving nucleotide metabolism and biochemical pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 54394-90-0
Cytidine 5'-triphosphate trisodium salt
nucleoside triphosphate research reagent
Cytidine-5'-triphosphate disodium salt
nucleoside triphosphate biochemical reagent
Cytidine triphosphate disodium dihydrate
Nucleotide research reagent
Guanosine-5'-diphosphate disodium salt
nucleoside diphosphate research reagent
1-IODOHEXADECANE
Laboratory reagent
Dimethylzinc
organometallic reagent for chemical synthesis
3-(1-(Dimethylamino)ethyl)phenol hydrochloride
research compound
2-IODO-5-METHOXYBENZOIC ACID
research compound for chemical synthesis
disodium;[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate
ZGDYAAWYYNVXEB-WFIJOQBCSA-L
C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)(O)[O-])O)O.[Na+].[Na+]