(2H8)Naphthalene is a deuterium-labeled form of naphthalene where all eight hydrogen atoms are replaced by deuterium. It is primarily used as an isotopically labeled reference standard in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1146-65-2
2,6-Di-iso-propylphenol-d18
isotopically labeled reference standard
4-Acetaminophen-d3 Sulfate Potassium Salt
isotopically labeled reference standard
L-Phenyl-d5-alanine-2,3,3-d3
isotopically labeled reference standard
Acyclovir-d4 L-Leucinate
isotopically labeled reference standard
MMT-Hexylaminolinker Phosphoramidite
oligonucleotide synthesis phosphoramidite reagent
(S)-2-(3-Bromophenyl)propanoic acid
Pharmaceutical intermediate or research compound
3-bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine
research compound
Adenosine 5'-diphosphate dipotassium salt
Nucleoside Diphosphate Series
1,2,3,4,5,6,7,8-octadeuterionaphthalene
UFWIBTONFRDIAS-PGRXLJNUSA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H]