(2H8)Naphthalene is a deuterium-labeled form of naphthalene where all eight hydrogen atoms are replaced by deuterium. It is primarily used as an isotopically labeled reference standard in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2H8)Naphthalene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,6-Di-iso-propylphenol-d18
isotopically labeled reference standard
4-Acetaminophen-d3 Sulfate Potassium Salt
isotopically labeled reference standard
L-Phenyl-d5-alanine-2,3,3-d3
isotopically labeled reference standard
Acyclovir-d4 L-Leucinate
isotopically labeled reference standard
MMT-Hexylaminolinker Phosphoramidite
oligonucleotide synthesis phosphoramidite reagent
(S)-2-(3-Bromophenyl)propanoic acid
Pharmaceutical intermediate or research compound
3-bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine
research compound
Adenosine 5'-diphosphate dipotassium salt
Nucleoside Diphosphate Series
1,2,3,4,5,6,7,8-octadeuterionaphthalene
UFWIBTONFRDIAS-PGRXLJNUSA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H]
(2H8)Naphthalene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.