Boc-Nva-OH is a protected amino acid derivative used in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino function and a free carboxyl group, making it suitable for solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
research compound
(2R)-6-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
protected amino acid for peptide synthesis
FMOC-D-allo-Isoleucine
protected amino acid for peptide synthesis
Boc-L-valine
protected amino acid for peptide synthesis
3-BROMOQUINOLINE
research compound
2-bromo-n-(2-methylphenyl)acetamide
Lidocaine impurity reference standard
Oxane-4-carboxylic acid
chemical building block for synthesis
2-bromo-5-chloro-3-methylthiophene
Research chemical reagent
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid
INWOAUUPYIXDHN-ZETCQYMHSA-N
CCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.