This compound is a protected amino acid derivative used in solid-phase peptide synthesis. It features orthogonal protecting groups on both the alpha-amino and side-chain amino functions, enabling selective deprotection during peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S)-2-{[(tert-butoxy)carbonyl]amino}-6-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
peptide synthesis building block
(2S)-2-{[(tert-butoxy)carbonyl]amino}-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanoic acid
peptide synthesis intermediate
(2S)-4-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
peptide synthesis intermediate
FMOC-D-allo-Isoleucine
protected amino acid for peptide synthesis
Boc-L-valine
protected amino acid for peptide synthesis
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid for peptide synthesis
Bromo(1-methylpropyl)magnesium
Grignard reagent for organic synthesis
4-BROMOBENZYLMAGNESIUM BROMIDE
Grignard reagent for organic synthesis
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
UMRUUWFGLGNQLI-JOCHJYFZSA-N
CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.