1,2,3,4,5-Pentadeuterio-6-methylbenzene is a deuterated analytical standard that serves as an isotopically labeled reference compound for quantitative analysis. Its structure features a methyl-substituted aromatic ring where five hydrogen atoms are replaced by deuterium, making it valuable for mass spectrometry and nuclear magnetic resonance spectroscopy calibration.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 1603-99-2
2-HEPTANONE-1,1,1,3,3-D5
research compound
(2E)-3-(²H₅)Phenyl(²H₂)prop-2-enoic acid
research compound
Dimethyl succinate-2,2,3,3-d4
research compound
(²H₁₀)Cyclohexanone
research compound
5-Bromo-4-chloro-3-indolyl-alpha-D-N-acetylneuraminic acid sodium salt
research compound
1-(1-Bromoethyl)-3,5-bis(trifluoromethyl)benzene
research compound
HEPPS
research compound
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-propyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI)
research compound
1,2,3,4,5-pentadeuterio-6-methylbenzene
YXFVVABEGXRONW-VIQYUKPQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C)[2H])[2H]