(2H10)Cyclohexanone is a fully deuterated analog of cyclohexanone, used as an analytical standard in research. Its isotopic labeling makes it valuable for mass spectrometry and nuclear magnetic resonance studies, particularly in structural chemistry investigations.
Content scope: Information here supports chemical identification and industrial supply, research, and manufacturing contexts. It is not a therapeutic claim, medical advice, or drug-use instructions.
Sourcing or supplying this compound?
List your inventory or post a purchase request
CAS 51209-49-5
2-HEPTANONE-1,1,1,3,3-D5
research compound
Di((2H3)methyl)ammonium chloride
research compound
Pentanedioic-d6 acid
research compound
Methylbenzene-d5
research compound
Tris(di(2H3)methylamido)phosphorus
research compound
4-Biphenylboronic acid
research compound
Biphenyl-3-boronic acid
research compound
4-Iodophenylboronic acid
research compound
2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-one
JHIVVAPYMSGYDF-YXALHFAPSA-N
[2H]C1(C(=O)C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H]