Sodium pantothenate is the sodium salt of pantothenic acid, a water-soluble B vitamin (vitamin B5). It is an essential nutrient required by all animals for the synthesis of coenzyme A, which plays a critical role in cellular energy production and the metabolism of proteins, carbohydrates, and fats.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 867-81-2
Calcium pantothenate
Vitamin B5 dietary supplement
Potassium bitartrate
food acidity regulator and raising agent
Sodium tartrate
food emulsifier and sequestrant
CHOLINE BITARTRATE
dietary supplement and nutrient
L-tartaric acid
Food additive and acidulant
(+-)-Pantothenic acid
Vitamin B5 dietary supplement
Pantothenic acid
Vitamin B5 for dietary supplementation
sodium 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoate
GQTHJBOWLPZUOI-FJXQXJEOSA-M
CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.[Na+]