Dideoxy GTP is a dideoxynucleotide triphosphate used as a chain-terminating inhibitor in the Sanger method of DNA sequencing. It lacks hydroxyl groups at the 2' and 3' positions of the ribose sugar, preventing further DNA strand elongation by DNA polymerase.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 68726-28-3
3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate)
Nucleotide analogue research reagent
DdATP
DNA sequencing reagent
Boc-2-aminobenzoic acid
research compound
5-Bromo-4,6-dichloropyrimidine
Research chemical intermediate
Ethylenediaminetriacetic acid
chelating agent
4-Methoxy-3-methylbenzoic Acid
research compound
[[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
HDRRAMINWIWTNU-PRJDIBJQSA-N
C1CC(O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O