Ethylenediaminetriacetic acid is an ethylenediamine derivative where three of the four amine protons are replaced by carboxymethyl groups. It functions as a chelating agent and is also a bacterial xenobiotic metabolite.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 688-57-3
4-Methoxy-3-methylbenzoic Acid
research compound
Rhodium(II) 2,2,2-triphenylacetate
research compound for catalysis
1-Nitroso-L-tryptophan
nitrosamine impurity reference standard
Allyl (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-aminobutanoate
peptide synthesis building block
2-[2-[bis(carboxymethyl)amino]ethylamino]acetic acid
OUDSFQBUEBFSPS-UHFFFAOYSA-N
C(CN(CC(=O)O)CC(=O)O)NCC(=O)O