1-Nitroso-L-tryptophan is a nitrosamine impurity reference standard derived from the amino acid tryptophan. It is primarily used as a reference compound in the research and quality control of pharmaceutical materials to detect and quantify nitrosamine impurities.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 68807-89-6
Allyl (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-aminobutanoate
peptide synthesis building block
AFLATOXIN M2
mycotoxin reference standard
4-(difluoromethoxy)benzeneboronic acid
Boronic acid research reagent
Dithioerythritol
Reducing agent for disulfides
(2S)-2-amino-3-(1-nitrosoindol-3-yl)propanoic acid
WBQJTPDOGLYTBE-VIFPVBQESA-N
C1=CC=C2C(=C1)C(=CN2N=O)C[C@@H](C(=O)O)N