ddATP is a dideoxynucleotide triphosphate, a synthetic analog of natural ATP, that acts as a chain-terminating inhibitor of DNA polymerase. It is a key reagent in the Sanger method of DNA sequencing, where its incorporation into a growing DNA strand prevents further elongation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 24027-80-3
3'-Amino-3'-dATP
nucleotide research reagent
Dideoxy GTP
DNA sequencing reagent
2-(DIPHENYLPHOSPHINO)-2'-(N,N-DIMETHYLAMINO)BIPHENYL
Ligand for cross-coupling reactions
Pyridinium p-toluenesulfonate
Organocatalyst for chemical synthesis
4-Nitrophenylboronic acid
research compound for organic synthesis
3-[4-({2-[(2,3-dihydro-1H-inden-5-yl)amino]pyrimidin-4-yl}amino)-1-oxo-2,3-dihydro-1H-isoindol-2-yl]piperidine-2,6-dione
research compound
DdATP trisodium
Nucleotide analog research reagent
[[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
OAKPWEUQDVLTCN-NKWVEPMBSA-N
C1C[C@@H](O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N2C=NC3=C(N=CN=C32)N