3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate) is a modified nucleotide analogue used in biochemical research. Its structure features a guanine base attached to a deoxyribose sugar with an amino group at the 3' position and a triphosphate chain, making it a valuable tool for studying nucleic acid synthesis and enzyme mechanisms.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 90053-19-3
Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate intermediate
DGTP
research compound
Dideoxy GTP
DNA sequencing reagent
JI-101
research compound
(S)-Methyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
1-Phenyl-d5-ethanol
deuterated research standard
(2-ethylhexyl)magnesium bromide
Grignard reagent for organic synthesis
[[(2S,3S,5R)-3-amino-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
ILTYANYMUGEMNF-KVQBGUIXSA-N
C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N