L-Glutamic Acid-d5 is a deuterated form of the amino acid L-glutamic acid, commonly used as an analytical standard in research. Its isotopic labeling enables precise quantification in mass spectrometry and nuclear magnetic resonance studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2784-50-1
L-Glutamine-d5
stable isotope labeled research standard
Aldoview precursor
research compound
Acetamide, N-[2-(5-methoxy-1-nitroso-1H-indol-3-yl)ethyl]-
Nitrosamine reference standard
Integrin Binding Peptide
integrin binding research reagent
N-Nitrosocarbazole
Nitrosamine impurity reference standard
Monosodium DL-glutamate
flavor enhancer
L-glutamic acid
nutritional supplement and flavor enhancer
Sodium glutamate monohydrate
flavor enhancer
(2S)-2-amino-2,3,3,4,4-pentadeuteriopentanedioic acid
WHUUTDBJXJRKMK-NKXUJHECSA-N
[2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)O)N