L-Cysteine-d2 is a deuterium-labeled form of the amino acid L-cysteine, specifically deuterated at the beta-carbon. It is primarily used as a research compound for studies involving metabolic tracing and protein labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 130633-02-2
3-Bromo-5-fluorobenzotrifluoride
research reagent
Hexyl (amino(4-aminophenyl)methylene)carbamate hydrochloride
research compound
(3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid
Boronic acid building block
Bicyclo[2.2.1]hept-5-en-2-ol
chemical intermediate for synthesis
D-Cysteine hydrochloride
research compound
Cystein chloride
dough conditioner and nutritional supplement
L-cysteine
Flavor and nutrition additive
L-Cysteine hydrochloride monohydrate
flavor enhancer and nutritional supplement
(2R)-2-amino-3,3-dideuterio-3-sulfanylpropanoic acid
XUJNEKJLAYXESH-XFJCSJJYSA-N
[2H]C([2H])([C@@H](C(=O)O)N)S