3-Bromo-5-fluorobenzotrifluoride is an aromatic compound containing bromine, fluorine, and a trifluoromethyl group. It is primarily used as a research reagent in chemical synthesis and laboratory applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 130723-13-6
Hexyl (amino(4-aminophenyl)methylene)carbamate hydrochloride
research compound
(3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid
Boronic acid building block
Bicyclo[2.2.1]hept-5-en-2-ol
chemical intermediate for synthesis
Pyridin-4-ylmethanesulfonyl Chloride
research chemical for synthesis
1-bromo-3-fluoro-5-(trifluoromethyl)benzene
LIGBGEJPUQBLTG-UHFFFAOYSA-N
C1=C(C=C(C=C1F)Br)C(F)(F)F
—