1-Thianthrenylboronic Acid is a research reagent used in boronic acid chemistry. It contains varying amounts of anhydride and features a polycyclic structure with two aromatic rings and a heterocycle.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 108847-76-3
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
البورون ثلاثي فلوريد الأثير
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Thianthren
research compound for phosphorescence studies
Thianthren-2-ylboronic acid
research chemical
thianthren-1-ylboronic acid
FZEWPLIHPXGNTB-UHFFFAOYSA-N
B(C1=C2C(=CC=C1)SC3=CC=CC=C3S2)(O)O