(2S)-1,1,2-triphenylethane-1,2-diol is a chiral organic compound featuring two alcohol groups and three aromatic rings. It is primarily supplied as a research reagent for laboratory and synthetic chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 108998-83-0
البورون ثلاثي فلوريد الأثير
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Fmoc-Pro-OSu
research reagent for peptide synthesis
3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid
research compound
(R)-(+)-2-hydroxy-1,2,2-triphenylethyl acetate
Pharmaceutical intermediate
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
(2S)-1,1,2-triphenylethane-1,2-diol
GWVWUZJOQHWMFB-IBGZPJMESA-N
C1=CC=C(C=C1)[C@@H](C(C2=CC=CC=C2)(C3=CC=CC=C3)O)O