This compound is a chiral pharmaceutical intermediate featuring a triphenylethanol core with an acetate ester group. Its primary significance lies in its use as a building block in the synthesis of more complex pharmaceutical molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 95061-47-5
3-Bromo-1H-pyrazol-5-amine
Pharmaceutical intermediate
3-amino-6-chloropyridine-2-carbonitrile
Pharmaceutical intermediate for synthesis
2'-DEOXYURIDINE
nucleoside pharmaceutical intermediate
3,4,5-Trimethoxyphenylacetic acid
pharmaceutical intermediate for phenethylamine synthesis
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
[(1R)-2-hydroxy-1,2,2-triphenylethyl] acetate
GXLZCXZLVDUDHP-OAQYLSRUSA-N
CC(=O)O[C@H](C1=CC=CC=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O
—