Thianthren-2-ylboronic acid is a boronic acid derivative of thianthrene, a sulfur-containing heterocyclic compound. It is typically used as a research chemical in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 108847-21-8
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
البورون ثلاثي فلوريد الأثير
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
Thianthren
research compound for phosphorescence studies
thianthren-2-ylboronic acid
GCSOJZMPHLRBMJ-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)SC3=CC=CC=C3S2)(O)O