This compound is a deuterated analytical reference standard, specifically a stable isotope-labeled derivative of a tetrazole-containing carboxylic acid. Its primary significance lies in its use as a precisely labeled internal standard for quantitative analysis, enabling accurate measurement of the corresponding non-labeled compound in complex samples.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1089736-72-0
Alanine Valsartan
pharmaceutical impurity reference standard
(2S)-1,1,2-triphenylethane-1,2-diol
research compound
البورون ثلاثي فلوريد الأثير
NMR chemical shift reference compound
7-Methoxy-3-indolecarboxaldehyde
Research compound
Fmoc-Pro-OSu
research reagent for peptide synthesis
(2S)-3-methyl-2-[2,2,3,3,4,4,5,5,5-nonadeuteriopentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid
pharmaceutical reference standard
فالسارتان
active pharmaceutical ingredient
D-Valsartan
pharmaceutical impurity reference standard
(2S)-2,3,4,4,4-pentadeuterio-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-(trideuteriomethyl)butanoic acid
ACWBQPMHZXGDFX-KFWZLTATSA-N
[2H][C@@](C(=O)O)(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])N(CC1=CC=C(C=C1)C2=CC=CC=C2C3=NNN=N3)C(=O)CCCC