9,9-Dimethyl-9H-fluoren-2-amine is a research compound featuring a fluorene core with a dimethyl substituent at the 9-position and an amino group. It is primarily used in laboratory settings as a building block for chemical synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 108714-73-4
Dibenzothiophene-4-boronic acid
boronic acid research reagent
Thianthren-2-ylboronic acid
research chemical
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
(S)-(-)-Valsartan-d8(valine-d8)
deuterated analytical reference standard
9,9-dimethylfluoren-2-amine
GUTJITRKAMCHSD-UHFFFAOYSA-N
CC1(C2=CC=CC=C2C3=C1C=C(C=C3)N)C