This compound is a quaternary ammonium salt with a tricyclic cage structure, commonly used as a research reagent. It features an alcohol functional group and is typically supplied as a bromide salt for laboratory applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1086639-59-9
9,9-dimethyl-9H-fluoren-2-amine
research compound
Dibenzothiophene-4-boronic acid
boronic acid research reagent
Thianthren-2-ylboronic acid
research chemical
1-Thianthrenylboronic Acid (contains varying amounts of Anhydride)
Research compound for boronic acid chemistry
2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanol bromide
HBPXFHNNLMCUPA-UHFFFAOYSA-M
C1N2CN3CN1C[N+](C2)(C3)CCO.[Br-]