This compound is a deuterium-labeled version of phenethyl alcohol, where five hydrogen atoms on the aromatic ring are replaced with deuterium. It is primarily used as a reference standard in analytical chemistry, enabling precise quantification and identification in techniques such as mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Phenethyl Alcohol-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Phenol-2,3,4,5,6-d5
reference standard for analytical chemistry
P,p'-DDT-d8
reference standard for analytical chemistry
(2-BROMOETHYL)BENZENE-D5
deuterated research reagent
4-Bromo-2,8-bis(trifluoromethyl)quinoline
research compound
5-Bromo-6-chloropyridin-2-amine
research compound
4-Phenylbutyric Acid-d11
deuterated research compound
2-PHENYLETHANOL
fragrance and flavoring agent
2-(2,3,4,5,6-pentadeuteriophenyl)ethanol
WRMNZCZEMHIOCP-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])CCO)[2H])[2H]
Phenethyl Alcohol-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.