Phenol-2,3,4,5,6-d5 is a deuterium-labeled isotopologue of phenol, where all five aromatic hydrogen atoms are replaced with deuterium. It is primarily used as a reference standard in analytical chemistry for quantification and method development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Phenol-2,3,4,5,6-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
P,p'-DDT-d8
reference standard for analytical chemistry
Phenethyl Alcohol-d5
reference standard for analytical chemistry
Disodium ((2-amino-2-oxoethyl)(carboxylatomethyl)amino)acetate
chelating buffer component
(R)-2-METHYLPYRROLIDINE
Research compound
1H-indazol-4-amine
Research compound for pharmaceutical studies
4-CHLOROTHIAZOLE
chemical research reagent
Deuteriooxybenzene
Deuterated research reagent
페놀
disinfectant and antiseptic agent
Phenol-2,3,4,5,6-d5(CAS 4165-62-2)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2,3,4,5,6-pentadeuteriophenol
ISWSIDIOOBJBQZ-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])O)[2H])[2H]
Phenol-2,3,4,5,6-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.