p,p'-DDT-d8 is a deuterium-labeled analog of the organochlorine compound DDT, specifically used as a reference standard in analytical chemistry. Its primary significance lies in providing a stable isotope-labeled internal standard for the quantification of DDT residues in environmental and biological samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
P,p'-DDT-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Phenethyl Alcohol-d5
reference standard for analytical chemistry
Phenol-2,3,4,5,6-d5
reference standard for analytical chemistry
P,p'-DDD-d8
isotopically labeled research compound
3,3',4,4'-TETRACHLOROBIPHENYL-D6
isotopically labeled research compound
Pyrazine-2,6-dicarboxylic Acid
research compound
P-Toluenesulfonyl azide
Synthetic reagent for diazo transfer
1-Chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]benzene
insecticide and pesticide
1-chloro-2,3,5,6-tetradeuterio-4-[2,2,2-trichloro-1-(4-chloro-2,3,5,6-tetradeuteriophenyl)ethyl]benzene
YVGGHNCTFXOJCH-PGRXLJNUSA-N
[2H]C1=C(C(=C(C(=C1C(C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])C(Cl)(Cl)Cl)[2H])[2H])Cl)[2H]
P,p'-DDT-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.