p,p'-DDD-d8 is a deuterium-labeled research compound used primarily as an internal standard in analytical chemistry. It is a stable isotope analog of the pesticide p,p'-DDD, containing eight deuterium atoms, which allows for precise quantification in environmental and biological studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
P,p'-DDD-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,3',4,4'-TETRACHLOROBIPHENYL-D6
isotopically labeled research compound
L-Serine-d2
isotopically labeled research compound
2-NP-SCA 13C,15N2
isotopically labeled research compound
4-Aminophenol-d4
isotopically labeled research compound
Pyrazine-2,6-dicarboxylic Acid
research compound
P-Toluenesulfonyl azide
Synthetic reagent for diazo transfer
N-Phenylmaleimide
Research reagent for chemical synthesis
1,1',3,3'-tetrabenzyl-2,2-dibromo-hexadecahydro-2,2'-spirobi[cyclohexa[d]1,3-diaza-2-nickelacyclopentane]
research organometallic nickel complex
1-chloro-2,3,5,6-tetradeuterio-4-[2,2-dichloro-1-(4-chloro-2,3,5,6-tetradeuteriophenyl)ethyl]benzene
AHJKRLASYNVKDZ-PGRXLJNUSA-N
[2H]C1=C(C(=C(C(=C1C(C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])C(Cl)Cl)[2H])[2H])Cl)[2H]
P,p'-DDD-d8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.