L-Serine-d2 is a isotopically labeled research compound, specifically a deuterated form of the amino acid L-serine. It is primarily used as an internal standard or tracer in laboratory studies, particularly in metabolic and analytical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 95034-57-4
2-NP-SCA 13C,15N2
isotopically labeled research compound
Nitrobenzene-(1)(3)C
isotopically labeled research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
P,p'-DDD-d8
isotopically labeled research compound
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
Magnesium bromide 3-methylthiophen-2-ide (1/1/1)
research reagent for synthesis
Acetophenone, 2-phenyl-, oxime
research compound
(2S)-2-amino-3,3-dideuterio-3-hydroxypropanoic acid
MTCFGRXMJLQNBG-XFJCSJJYSA-N
[2H]C([2H])([C@@H](C(=O)O)N)O