4-Phenylbutyric Acid-d11 is a deuterated research compound, specifically a stable isotope-labeled analog of 4-phenylbutyric acid in which eleven hydrogen atoms are replaced by deuterium. Its primary significance lies in its use as a research reagent, enabling analytical and metabolic studies through isotope tracing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 358730-86-6
Diisobutyl Phthalate-d4
isotopically labeled research compound
4-Nonylphenol-D5
Deuterated analytical reference standard
Dicyclohexyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
2,6-DICHLOROTOLUENE-3,4,5-D3
Deuterated research compound
Sodium 4-phenylbutyrate
active pharmaceutical ingredient
4-PHENYLBUTYRIC ACID
Histone deacetylase inhibitor
2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid
OBKXEAXTFZPCHS-VRWITDQQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O)[2H])[2H]