2,6-Dichlorotoluene-3,4,5-d3 is a deuterated analog of 2,6-dichlorotoluene, where three hydrogen atoms on the aromatic ring are replaced with deuterium. This compound is used as a research reagent, particularly in studies requiring isotope labeling for tracking or analytical purposes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,6-DICHLOROTOLUENE-3,4,5-D3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Bromo(2-~2~H)propane
Deuterated research compound
2-BROMOBUTANE-D9
Deuterated research compound
Tris(di(2H3)methylamido)phosphorus
Deuterated research compound
L-Phenyl-d5-alanine
Deuterated research compound
Phenylalanyl adenylate
Research compound for aminoacylation studies
1-[6-(trifluoromethyl)pyridin-3-yl]ethan-1-one
Research compound
Fluoranthen-3-ylboronic acid
Chemical synthesis reagent
Methyl N-nitroso-L-prolinate
nitrosamine impurity reference standard
1,5-dichloro-2,3,4-trideuterio-6-methylbenzene
DMEDNTFWIHCBRK-NRUYWUNFSA-N
[2H]C1=C(C(=C(C(=C1[2H])Cl)C)Cl)[2H]
2,6-DICHLOROTOLUENE-3,4,5-D3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.