Diisobutyl Phthalate-d4 is a deuterium-labeled analog of diisobutyl phthalate, used as a research reagent in analytical and environmental studies. Its isotopic labeling allows for precise tracing and quantification in mass spectrometry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 358730-88-8
Ethyl bromoacetate-13C2
isotopically labeled research compound
2'-Deoxyadenosine monohydrate-1 inverted exclamation marka-13C
isotopically labeled research compound
1,3,5-Tribromobenzene-d3
isotopically labeled research compound
L-Phenylalanine-2-d1
isotopically labeled research compound
4-Nonylphenol-D5
Deuterated analytical reference standard
Dicyclohexyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
2,6-DICHLOROTOLUENE-3,4,5-D3
Deuterated research compound
Phenylalanyl adenylate
Research compound for aminoacylation studies
bis(2-methylpropyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
MGWAVDBGNNKXQV-KDWZCNHSSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC(C)C)C(=O)OCC(C)C)[2H])[2H]