L-Phenylalanine-2-d1 is a deuterium-labeled derivative of the amino acid L-phenylalanine, where one hydrogen atom at the 2-position is replaced by deuterium. It is primarily used as an isotopically labeled research compound in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-Phenylalanine-2-d1 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Aminophenol-d4
isotopically labeled research compound
2,4'-Dibromoacetophenone-2-13C
isotopically labeled research compound
Diisobutyl Phthalate-d4
isotopically labeled research compound
5-bromo-4-methylthiophene-2-carboxylic acid
research compound
5-Iodo-2-methylbenzoic acid
Research reagent
3,3',5,5'-TETRAMETHYLBENZIDINE
clinical reagent for testing blood
6-Bromo-1-methoxynaphthalene
research compound
L-Phenyl-d5-alanine
Deuterated research compound
L-Phenylalanine-2-d1(CAS 54793-54-3)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-2-amino-2-deuterio-3-phenylpropanoic acid
COLNVLDHVKWLRT-ZXEPEWCSSA-N
[2H][C@](CC1=CC=CC=C1)(C(=O)O)N
L-Phenylalanine-2-d1 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.