(2-Bromoethyl)benzene-d5 is a deuterated research reagent used in chemical and pharmaceutical research. Its structure features a bromoethyl group attached to a pentadeuterated benzene ring, making it useful as an internal standard or labeled compound in analytical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2-BROMOETHYL)BENZENE-D5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Bromo-2,8-bis(trifluoromethyl)quinoline
research compound
5-Bromo-6-chloropyridin-2-amine
research compound
4-Phenylbutyric Acid-d11
deuterated research compound
Diisobutyl Phthalate-d4
isotopically labeled research compound
(2-BROMOETHYL)BENZENE
pharmaceutical intermediate for beta-phenethyl derivatives
1-(2-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene
WMPPDTMATNBGJN-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])CCBr)[2H])[2H]
(2-BROMOETHYL)BENZENE-D5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.