This compound is the hydrochloride salt of N-(fluorenylmethoxycarbonyl)-L-lysine benzyl ester, a protected amino acid derivative commonly used in peptide synthesis. It features an Fmoc protecting group on the amino terminus and a benzyl ester on the carboxyl terminus, enabling selective deprotection during solid-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 159551-46-9
Fmoc-D-Lys-OH.HCl
Fmoc-protected amino acid intermediate
Fmoc-L-lysine
Protected amino acid for peptide synthesis
(2S)-6-amino-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid hydrochloride
Fmoc-protected lysine for peptide synthesis
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
(2S)-6-azido-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid building block
benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
YMCYNJUCGZDWCK-SNYZSRNZSA-N
C1=CC=C(C=C1)COC(=O)[C@H](CCCCN)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24.Cl