N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester, also known as Cbz-Tyr-OMe, is a protected amino acid derivative used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the amino function and a methyl ester on the carboxyl group, with a free phenolic hydroxyl group on the tyrosine side chain.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13512-31-7
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
Z-TYR(TBU)-OME
Protected amino acid intermediate
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
(1S)-1-(3-chlorophenyl)ethan-1-ol
Chiral building block for pharmaceuticals
3-(chloromethyl)-1-methyl-1H-1,2,4-triazole hydrochloride
pharmaceutical intermediate
methyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate
SLLMDHBKALJDBW-INIZCTEOSA-N
COC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OCC2=CC=CC=C2