N-Carbobenzoxy-D-phenylglycine (Cbz-D-Phg-OH) is a protected amino acid derivative used in peptide synthesis. Its structure features a benzyloxycarbonyl (Cbz) protecting group on the amino group, enabling selective incorporation of D-phenylglycine into peptide chains.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 17609-52-8
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
N-(Benzoxycarbonyl)-O-(tert-butyl)-L-serine
Peptide synthesis protected amino acid
5-Bromosalicylaldehyde
Pharmaceutical intermediate
3-hydrazinylbenzonitrile
Pharmaceutical intermediate
Amisulpride EP impurity C
Pharmaceutical impurity reference standard
3-(2-Bromoacetyl)pyridine hydrobromide
pharmaceutical intermediate
(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid
RLDJWBVOZVJJOS-CQSZACIVSA-N
C1=CC=C(C=C1)COC(=O)N[C@H](C2=CC=CC=C2)C(=O)O