This compound is a protected amino acid derivative used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the amino group and a tert-butyl group on the serine side chain, making it suitable for stepwise assembly of peptides in laboratory and manufacturing settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1676-75-1
(2S)-2-(9H-Fuoren-9-ylmethoxycarbonylamino)-6-((1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene)amino)hexanoic acid
Peptide synthesis protected amino acid
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
Fmoc-Thr(tBu)-Thr(Psi(Me,Me)pro)-OH
Protected amino acid building block
1-(3-methoxypropyl)piperidin-4-one
pharmaceutical intermediate
1-(benzothiophen-4-yl)piperazine;dihydrochloride
pharmaceutical intermediate
3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoic acid
TXDGEONUWGOCJG-UHFFFAOYSA-N
CC(C)(C)OCC(C(=O)O)NC(=O)OCC1=CC=CC=C1