N-Benzyloxycarbonyl-L-tyrosine is a protected amino acid derivative used as a reagent in peptide synthesis. It features a benzyloxycarbonyl (Z) protecting group attached to the amino function of L-tyrosine, making it valuable for stepwise peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-Benzyloxycarbonyl-L-tyrosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-(Benzyloxycarbonyl)-D-phenylalanine
Pharmaceutical intermediate for peptide synthesis
Carbobenzoxyphenylalanine
protected amino acid for peptide synthesis
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
N-Benzyloxycarbonyl-L-leucine
Peptide synthesis protecting group reagent
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
4'-Bromo-3,4-Dimethoxybenzophenone
Pharmaceutical intermediate
Methyl 4-methyl-3-(trifluoromethyl)benzoate
pharmaceutical intermediate
4-[5-(3,5-dichloro-phenyl)-5-trifluoromethyl-4,5-dihydro-isoxazol-3-yl]-2-methyl-benzoic acid tert-butyl ester
pharmaceutical intermediate
N-Benzyloxycarbonyl-L-tyrosine(CAS 1164-16-5)의 국제 HS 코드는 2924.29입니다.
2924.29
2924 29 70
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid
MCRMUCXATQAAMN-HNNXBMFYSA-N
C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O
N-Benzyloxycarbonyl-L-tyrosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.