N-(Benzyloxycarbonyl)-D-phenylalanine is a protected amino acid derivative commonly employed as a pharmaceutical intermediate in peptide synthesis. Its chemical structure features a benzyloxycarbonyl (Cbz) protecting group on the amine and a free carboxylic acid, making it suitable for solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-(Benzyloxycarbonyl)-D-phenylalanine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
3-Amino-N-((phenylmethoxy)carbonyl)-D-alanine
protected amino acid intermediate
(2R)-2-{[(benzyloxy)carbonyl]amino}butanedioic acid
Peptide synthesis intermediate
O-(1,1-Dimethylethyl)-N-((phenylmethoxy)carbonyl)-L-tyrosine
protected amino acid intermediate
3-((2S,5S)-5-(3-hydroxypropyl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
(1R,2R)-2-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid
Boc-protected amino acid intermediate
2-Amino-3-cyanopyridine
Pharmaceutical intermediate for anticancer derivatives
5'-Ethyl-2'-hydroxyacetophenone
pharmaceutical intermediate
(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid
RRONHWAVOYADJL-OAHLLOKOSA-N
C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2=CC=CC=C2
N-(Benzyloxycarbonyl)-D-phenylalanine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.