This compound is a Boc-protected amino acid intermediate, specifically the trans-(1R,2R)-isomer of a cyclopentane carboxylic acid derivative. It is primarily used in pharmaceutical manufacturing and research as a building block for peptide synthesis or other organic transformations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-((tert-Butoxycarbonyl)amino)-5-chlorobenzoic acid
Boc-protected amino acid intermediate
(1R,4R)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid
Boc-protected amino acid intermediate
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
3-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid
Boc-protected amino acid intermediate
2-Amino-3-cyanopyridine
Pharmaceutical intermediate for anticancer derivatives
5'-Ethyl-2'-hydroxyacetophenone
pharmaceutical intermediate
(1R,3AR,4S,7aR)-7a-methyl-1-((R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl)octahydro-1H-inden-4-ol
Falecalcitriol impurity reference standard
2,6-DIISOPROPYLANILINE
pharmaceutical intermediate
trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid
BUEPEVBYNBQNED-HTQZYQBOSA-N
CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]1C(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.