N-Benzyloxycarbonyl-L-leucine is a chemical compound used as a protecting group reagent in peptide synthesis. It is also the substrate for the enzyme Nα-benzyloxycarbonylleucine hydrolase, which catalyzes its hydrolysis to benzyl alcohol, carbon dioxide, and L-leucine.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2018-66-8
N-Benzyloxycarbonyl-L-tyrosine
Peptide synthesis protecting group reagent
N-(Benzyloxycarbonyl)-D-proline
Peptide synthesis protecting group reagent
6-BROMO-1-BENZOFURAN-3(2H)-ONE
Pharmaceutical intermediate
(3R,4S)-1-Benzoyl-3-(1-ethoxyethoxy)-4-phenylazetidin-2-one
synthetic intermediate for beta-lactam antibiotics
(2R,3R)-N-((1S,2R)-1-hydroxy-1-phenylpropan-2-yl)-3-Methoxy-2-Methyl-3-((S)-pyrrolidin-2-yl)propanaMide (hydrochloride)
peptide intermediate for pharmaceutical research
2-(3-chloro-5-fluorophenyl)acetic acid
Pharmaceutical intermediate for drug synthesis
(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid
USPFMEKVPDBMCG-LBPRGKRZSA-N
CC(C)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1