This compound is a hydrochloride salt of Fmoc-protected L-lysine, commonly used as a building block in solid-phase peptide synthesis. Its significance lies in the Fmoc (9-fluorenylmethoxycarbonyl) group, which temporarily protects the amino group during peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 139262-23-0
Fmoc-L-lysine
Protected amino acid for peptide synthesis
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
Aceclofenac Methyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Aceclofenac Ethyl Ester
Pharmaceutical intermediate for aceclofenac production
Aceclofenac Tert-Butyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Tert-butyl 4-(methoxy(methyl)carbamoyl)piperidine-1-carboxylate
Pharmaceutical intermediate
Fmoc-D-Lys-OH.HCl
Fmoc-protected amino acid intermediate
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride
MVMZFAIUUXYFGY-FYZYNONXSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O.Cl