2-Ethyl-D5-naphthalene is an isotope-labeled research compound used for analytical and tracer studies. Its structure incorporates deuterium atoms, enabling applications in mass spectrometry and metabolic research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Ethyl-D5-naphthalene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
CLENBUTEROL D9
isotope-labeled research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
2-Amino Nevirapine-d3
isotope-labeled research compound
Phenanthrene D10
isotope-labeled research compound
4-iso-Propylphenol-d12
deuterated research compound
(+/-)-Ketoprofen-d4
deuterated analytical reference standard
4-N-PENTYLPHENOL-D16
Deuterated research reference standard
2,6-Dichlorobenzoic acid-d3
deuterated research reagent
2-(1,1,2,2,2-pentadeuterioethyl)naphthalene
RJTJVVYSTUQWNI-ZBJDZAJPSA-N
[2H]C([2H])([2H])C([2H])([2H])C1=CC2=CC=CC=C2C=C1
2-Ethyl-D5-naphthalene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.