2,6-Dichlorobenzoic acid-d3 is a deuterated research reagent, specifically labeled with deuterium atoms at the 3, 4, and 5 positions of the aromatic ring. This isotopically labeled compound is used primarily in research settings where the deuterium label serves as a tracer or for analytical method development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,6-Dichlorobenzoic acid-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,4,6-trimethylpyridine-d11
deuterated analytical reference standard
2,3,4-trichlorobiphenyl-2',3',4',5',6'-d5
isotopically labeled research standard
3,4,5-Trimethoxybenzyl-d9 Alcohol
deuterated research reference standard
4,4'-dichlorobiphenyl-d8
deuterated analytical reference standard
2,6-DICHLOROBENZOIC ACID
Agrochemical intermediate and metabolite
2,6-dichloro-3,4,5-trideuteriobenzoic acid
MRUDNSFOFOQZDA-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1[2H])Cl)C(=O)O)Cl)[2H]
2,6-Dichlorobenzoic acid-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.