Phenanthrene D10 is a deuterium-labeled derivative of phenanthrene used as an internal standard in analytical chemistry and research applications. Its isotopic labeling allows for precise quantification in mass spectrometry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Phenanthrene D10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Chrysene, perdeutero-
Deuterated internal standard for analysis
Dibenz[a,h]anthracene-d14
deuterated internal standard for analysis
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioic acid
isotope-labeled research compound
4-Fluoroaniline-2,3,5,6-d4
isotope-labeled research compound
4-Methylcatechol-d8
isotope-labeled research compound
2-Ethyl-D5-naphthalene
isotope-labeled research compound
(S)-1-Phenyl-2-propanol
research compound
(1R)-1-(4-methoxyphenyl)ethan-1-ol
research chemical
Phenanthrene D10(CAS 1517-22-2)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,2,3,4,5,6,7,8,9,10-decadeuteriophenanthrene
YNPNZTXNASCQKK-LHNTUAQVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C3=C(C(=C(C(=C32)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]
Phenanthrene D10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.