This compound is an isotope-labeled research reagent designed for use in analytical and biochemical studies. It is structurally characterized by a deuterated methyl group and multiple polar functional groups, making it suitable for tracing applications in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methotrexate 5-methyl ester
pharmaceutical intermediate for methotrexate derivatives
Phenanthrene D10
isotope-labeled research compound
CLENBUTEROL D9
isotope-labeled research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
Acetaminophen Dimer-d6
isotope-labeled research compound
2-(Trifluoromethyl)benzoic acid
research compound
4-Ethoxycarbonylphenylboronic acid
Boronic acid research reagent
(2-Carboxyethyl)dimethylsulfonium Chloride
Research biochemical intermediate
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioic acid
FBOZXECLQNJBKD-FUPFOCIHSA-N
[2H]C([2H])([2H])N(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.