Clenbuterol D9 is an isotope-labeled research compound, specifically a deuterated form of clenbuterol, featuring nine deuterium atoms. It is commonly used in analytical research as an internal standard for mass spectrometry due to its stable isotope labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 129138-58-5
Clenbuterol-d9 hydrochloride
active pharmaceutical ingredient
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
deuterated research standard
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
2-Amino Nevirapine-d3
isotope-labeled research compound
4-Fluoroaniline-2,3,5,6-d4
isotope-labeled research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
Phenanthrene D10
isotope-labeled research compound
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-prolinyl-L-proline
research compound for peptide synthesis
1-(4-amino-3,5-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
STJMRWALKKWQGH-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O