This compound is a deuterium-labeled research standard, specifically a stable isotope-labeled analogue of a chemical used in laboratory studies. Its primary significance lies in its use as an internal standard for analytical methods, such as mass spectrometry, due to the incorporation of nine deuterium atoms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
CLENBUTEROL D9
isotope-labeled research compound
Clenbuterol-d9 hydrochloride
active pharmaceutical ingredient
3,4-Diaminotoluene-d6
deuterated reference standard
Carbanide;cyclopentene;ditert-butyl-[(1S)-1-(2-dicyclohexylphosphanylcyclopentyl)ethyl]phosphane;iron(2+)
organometallic catalyst ligand complex
Didesmethyl almotriptan hemifumarate
analytical impurity reference standard
2-fluoro-4-iodobenzoic acid
Research compound
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
JSJCTEKTBOKRST-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.